C22H33N7O2 — CID 111367541
4-[(3,4-dimethoxyphenyl)methyl]-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-prop-2-enylpiperazine-1-carboximidamide (PubChem CID 111367541) has the molecular formula C22H33N7O2 and a molecular weight of 427.55 g/mol. Its IUPAC name is 4-[(3,4-dimethoxyphenyl)methyl]-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-prop-2-enylpiperazine-1-carboximidamide.
| Compound Name | 4-[(3,4-dimethoxyphenyl)methyl]-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-prop-2-enylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111367541 |
| Molecular Formula | C22H33N7O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | 4-[(3,4-dimethoxyphenyl)methyl]-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-prop-2-enylpiperazine-1-carboximidamide |
| SMILES | C=CCN/C(=N\Cc1nnc(C)n1C)N1CCN(Cc2ccc(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C22H33N7O2/c1-6-9-23-22(24-15-21-26-25-17(2)27(21)3)29-12-10-28(11-13-29)16-18-7-8-19(30-4)20(14-18)31-5/h6-8,14H,1,9-13,15-16H2,2-5H3,(H,23,24) |
| InChIKey | YLKCVYHLJWBXNB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|