C20H29ClIN7 — CID 111264366
4-(5-chloro-2-methylphenyl)-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-prop-2-enylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111264366) has the molecular formula C20H29ClIN7 and a molecular weight of 529.86 g/mol. Its IUPAC name is 4-(5-chloro-2-methylphenyl)-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-prop-2-enylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(5-chloro-2-methylphenyl)-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-prop-2-enylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111264366 |
| Molecular Formula | C20H29ClIN7 |
| Molecular Weight | 529.86 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | 4-(5-chloro-2-methylphenyl)-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-prop-2-enylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C=CCN/C(=N\Cc1nnc(C)n1C)N1CCN(c2cc(Cl)ccc2C)CC1.I |
| InChI | InChI=1S/C20H28ClN7.HI/c1-5-8-22-20(23-14-19-25-24-16(3)26(19)4)28-11-9-27(10-12-28)18-13-17(21)7-6-15(18)2;/h5-7,13H,1,8-12,14H2,2-4H3,(H,22,23);1H |
| InChIKey | NJNAODKNTPXNSR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.86 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|