C20H28ClN5O — CID 111264361
4-(5-chloro-2-methylphenyl)-N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylpiperazine-1-carboximidamide (PubChem CID 111264361) has the molecular formula C20H28ClN5O and a molecular weight of 389.93 g/mol. Its IUPAC name is 4-(5-chloro-2-methylphenyl)-N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylpiperazine-1-carboximidamide.
| Compound Name | 4-(5-chloro-2-methylphenyl)-N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111264361 |
| Molecular Formula | C20H28ClN5O |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 4-(5-chloro-2-methylphenyl)-N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1nc(C)c(C)o1)N1CCN(c2cc(Cl)ccc2C)CC1 |
| InChI | InChI=1S/C20H28ClN5O/c1-5-22-20(23-13-19-24-15(3)16(4)27-19)26-10-8-25(9-11-26)18-12-17(21)7-6-14(18)2/h6-7,12H,5,8-11,13H2,1-4H3,(H,22,23) |
| InChIKey | KGCAWHMAFLXGBR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 56.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|