C21H31IN4O — CID 111152697
4-benzyl-N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 111152697) has the molecular formula C21H31IN4O and a molecular weight of 482.41 g/mol. Its IUPAC name is 4-benzyl-N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | 4-benzyl-N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111152697 |
| Molecular Formula | C21H31IN4O |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 4-benzyl-N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(C)c(C)o1)N1CCC(Cc2ccccc2)CC1.I |
| InChI | InChI=1S/C21H30N4O.HI/c1-4-22-21(23-15-20-24-16(2)17(3)26-20)25-12-10-19(11-13-25)14-18-8-6-5-7-9-18;/h5-9,19H,4,10-15H2,1-3H3,(H,22,23);1H |
| InChIKey | BRQSHVLEHPTMLA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|