C19H30IN3 — CID 111152565
4-benzyl-N'-(cyclopropylmethyl)-N-ethylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 111152565) has the molecular formula C19H30IN3 and a molecular weight of 427.37 g/mol. Its IUPAC name is 4-benzyl-N'-(cyclopropylmethyl)-N-ethylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | 4-benzyl-N'-(cyclopropylmethyl)-N-ethylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111152565 |
| Molecular Formula | C19H30IN3 |
| Molecular Weight | 427.37 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 4-benzyl-N'-(cyclopropylmethyl)-N-ethylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC1CC1)N1CCC(Cc2ccccc2)CC1.I |
| InChI | InChI=1S/C19H29N3.HI/c1-2-20-19(21-15-18-8-9-18)22-12-10-17(11-13-22)14-16-6-4-3-5-7-16;/h3-7,17-18H,2,8-15H2,1H3,(H,20,21);1H |
| InChIKey | IPKRZTSZHSSMJM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|