C21H35IN4O — CID 111152485
2-[[(4-benzylpiperidin-1-yl)-(ethylamino)methylidene]amino]-N-tert-butylacetamide;hydroiodide (PubChem CID 111152485) has the molecular formula C21H35IN4O and a molecular weight of 486.44 g/mol. Its IUPAC name is 2-[[(4-benzylpiperidin-1-yl)-(ethylamino)methylidene]amino]-N-tert-butylacetamide;hydroiodide.
| Compound Name | 2-[[(4-benzylpiperidin-1-yl)-(ethylamino)methylidene]amino]-N-tert-butylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111152485 |
| Molecular Formula | C21H35IN4O |
| Molecular Weight | 486.44 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 2-[[(4-benzylpiperidin-1-yl)-(ethylamino)methylidene]amino]-N-tert-butylacetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)NC(C)(C)C)N1CCC(Cc2ccccc2)CC1.I |
| InChI | InChI=1S/C21H34N4O.HI/c1-5-22-20(23-16-19(26)24-21(2,3)4)25-13-11-18(12-14-25)15-17-9-7-6-8-10-17;/h6-10,18H,5,11-16H2,1-4H3,(H,22,23)(H,24,26);1H |
| InChIKey | XVVRKHVDKWEAOW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|