C19H31N5O2 — CID 111184572
N-tert-butyl-2-[[ethylamino-[4-(2-hydroxyphenyl)piperazin-1-yl]methylidene]amino]acetamide (PubChem CID 111184572) has the molecular formula C19H31N5O2 and a molecular weight of 361.49 g/mol. Its IUPAC name is N-tert-butyl-2-[[ethylamino-[4-(2-hydroxyphenyl)piperazin-1-yl]methylidene]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[ethylamino-[4-(2-hydroxyphenyl)piperazin-1-yl]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111184572 |
| Molecular Formula | C19H31N5O2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.25 |
| IUPAC Name | N-tert-butyl-2-[[ethylamino-[4-(2-hydroxyphenyl)piperazin-1-yl]methylidene]amino]acetamide |
| SMILES | CCN/C(=N\CC(=O)NC(C)(C)C)N1CCN(c2ccccc2O)CC1 |
| InChI | InChI=1S/C19H31N5O2/c1-5-20-18(21-14-17(26)22-19(2,3)4)24-12-10-23(11-13-24)15-8-6-7-9-16(15)25/h6-9,25H,5,10-14H2,1-4H3,(H,20,21)(H,22,26) |
| InChIKey | ZNUVPGLHOIRYHP-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|