C21H24F3N5O2 — CID 111185670
2-[[ethylamino-[4-(2-hydroxyphenyl)piperazin-1-yl]methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 111185670) has the molecular formula C21H24F3N5O2 and a molecular weight of 435.45 g/mol. Its IUPAC name is 2-[[ethylamino-[4-(2-hydroxyphenyl)piperazin-1-yl]methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[ethylamino-[4-(2-hydroxyphenyl)piperazin-1-yl]methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 111185670 |
| Molecular Formula | C21H24F3N5O2 |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 2-[[ethylamino-[4-(2-hydroxyphenyl)piperazin-1-yl]methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CCN/C(=N\CC(=O)Nc1ccc(F)c(F)c1F)N1CCN(c2ccccc2O)CC1 |
| InChI | InChI=1S/C21H24F3N5O2/c1-2-25-21(26-13-18(31)27-15-8-7-14(22)19(23)20(15)24)29-11-9-28(10-12-29)16-5-3-4-6-17(16)30/h3-8,30H,2,9-13H2,1H3,(H,25,26)(H,27,31) |
| InChIKey | ACNQJTLRYXPIEB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|