C23H30FN5O2 — CID 111185314
N-[2-[[ethylamino-[4-(2-hydroxyphenyl)piperazin-1-yl]methylidene]amino]ethyl]-2-(4-fluorophenyl)acetamide (PubChem CID 111185314) has the molecular formula C23H30FN5O2 and a molecular weight of 427.52 g/mol. Its IUPAC name is N-[2-[[ethylamino-[4-(2-hydroxyphenyl)piperazin-1-yl]methylidene]amino]ethyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[2-[[ethylamino-[4-(2-hydroxyphenyl)piperazin-1-yl]methylidene]amino]ethyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 111185314 |
| Molecular Formula | C23H30FN5O2 |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | N-[2-[[ethylamino-[4-(2-hydroxyphenyl)piperazin-1-yl]methylidene]amino]ethyl]-2-(4-fluorophenyl)acetamide |
| SMILES | CCN/C(=N\CCNC(=O)Cc1ccc(F)cc1)N1CCN(c2ccccc2O)CC1 |
| InChI | InChI=1S/C23H30FN5O2/c1-2-25-23(27-12-11-26-22(31)17-18-7-9-19(24)10-8-18)29-15-13-28(14-16-29)20-5-3-4-6-21(20)30/h3-10,30H,2,11-17H2,1H3,(H,25,27)(H,26,31) |
| InChIKey | JXAGABQYWPROBM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|