C19H30FIN4O — CID 111144923
N-[2-[[ethylamino-(3-methylpiperidin-1-yl)methylidene]amino]ethyl]-2-(4-fluorophenyl)acetamide;hydroiodide (PubChem CID 111144923) has the molecular formula C19H30FIN4O and a molecular weight of 476.38 g/mol. Its IUPAC name is N-[2-[[ethylamino-(3-methylpiperidin-1-yl)methylidene]amino]ethyl]-2-(4-fluorophenyl)acetamide;hydroiodide.
| Compound Name | N-[2-[[ethylamino-(3-methylpiperidin-1-yl)methylidene]amino]ethyl]-2-(4-fluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111144923 |
| Molecular Formula | C19H30FIN4O |
| Molecular Weight | 476.38 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | N-[2-[[ethylamino-(3-methylpiperidin-1-yl)methylidene]amino]ethyl]-2-(4-fluorophenyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)Cc1ccc(F)cc1)N1CCCC(C)C1.I |
| InChI | InChI=1S/C19H29FN4O.HI/c1-3-21-19(24-12-4-5-15(2)14-24)23-11-10-22-18(25)13-16-6-8-17(20)9-7-16;/h6-9,15H,3-5,10-14H2,1-2H3,(H,21,23)(H,22,25);1H |
| InChIKey | NBIKNLUSKDVYKU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|