C19H30IN3O2 — CID 111143831
methyl 4-[2-[[ethylamino-(3-methylpiperidin-1-yl)methylidene]amino]ethyl]benzoate;hydroiodide (PubChem CID 111143831) has the molecular formula C19H30IN3O2 and a molecular weight of 459.37 g/mol. Its IUPAC name is methyl 4-[2-[[ethylamino-(3-methylpiperidin-1-yl)methylidene]amino]ethyl]benzoate;hydroiodide.
| Compound Name | methyl 4-[2-[[ethylamino-(3-methylpiperidin-1-yl)methylidene]amino]ethyl]benzoate;hydroiodide |
|---|---|
| PubChem CID | 111143831 |
| Molecular Formula | C19H30IN3O2 |
| Molecular Weight | 459.37 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | methyl 4-[2-[[ethylamino-(3-methylpiperidin-1-yl)methylidene]amino]ethyl]benzoate;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccc(C(=O)OC)cc1)N1CCCC(C)C1.I |
| InChI | InChI=1S/C19H29N3O2.HI/c1-4-20-19(22-13-5-6-15(2)14-22)21-12-11-16-7-9-17(10-8-16)18(23)24-3;/h7-10,15H,4-6,11-14H2,1-3H3,(H,20,21);1H |
| InChIKey | NESMTWZWFRHJTC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|