C17H26F2IN3 — CID 111145705
N'-[2-(2,6-difluorophenyl)ethyl]-N-ethyl-3-methylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 111145705) has the molecular formula C17H26F2IN3 and a molecular weight of 437.32 g/mol. Its IUPAC name is N'-[2-(2,6-difluorophenyl)ethyl]-N-ethyl-3-methylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(2,6-difluorophenyl)ethyl]-N-ethyl-3-methylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111145705 |
| Molecular Formula | C17H26F2IN3 |
| Molecular Weight | 437.32 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | N'-[2-(2,6-difluorophenyl)ethyl]-N-ethyl-3-methylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCc1c(F)cccc1F)N1CCCC(C)C1.I |
| InChI | InChI=1S/C17H25F2N3.HI/c1-3-20-17(22-11-5-6-13(2)12-22)21-10-9-14-15(18)7-4-8-16(14)19;/h4,7-8,13H,3,5-6,9-12H2,1-2H3,(H,20,21);1H |
| InChIKey | BJYMGWHAWQSURT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|