C18H27F2IN4O2 — CID 111164474
ethyl 4-[N'-[2-(2,6-difluorophenyl)ethyl]-N-ethylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111164474) has the molecular formula C18H27F2IN4O2 and a molecular weight of 496.34 g/mol. Its IUPAC name is ethyl 4-[N'-[2-(2,6-difluorophenyl)ethyl]-N-ethylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[N'-[2-(2,6-difluorophenyl)ethyl]-N-ethylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111164474 |
| Molecular Formula | C18H27F2IN4O2 |
| Molecular Weight | 496.34 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | ethyl 4-[N'-[2-(2,6-difluorophenyl)ethyl]-N-ethylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CCc1c(F)cccc1F)N1CCN(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C18H26F2N4O2.HI/c1-3-21-17(22-9-8-14-15(19)6-5-7-16(14)20)23-10-12-24(13-11-23)18(25)26-4-2;/h5-7H,3-4,8-13H2,1-2H3,(H,21,22);1H |
| InChIKey | GAYCWCMRHLUPMV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|