C21H32IN5O2 — CID 111164580
ethyl 4-[N-ethyl-N'-[2-(2-methyl-1H-indol-3-yl)ethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111164580) has the molecular formula C21H32IN5O2 and a molecular weight of 513.42 g/mol. Its IUPAC name is ethyl 4-[N-ethyl-N'-[2-(2-methyl-1H-indol-3-yl)ethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[N-ethyl-N'-[2-(2-methyl-1H-indol-3-yl)ethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111164580 |
| Molecular Formula | C21H32IN5O2 |
| Molecular Weight | 513.42 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | ethyl 4-[N-ethyl-N'-[2-(2-methyl-1H-indol-3-yl)ethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CCc1c(C)[nH]c2ccccc12)N1CCN(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C21H31N5O2.HI/c1-4-22-20(25-12-14-26(15-13-25)21(27)28-5-2)23-11-10-17-16(3)24-19-9-7-6-8-18(17)19;/h6-9,24H,4-5,10-15H2,1-3H3,(H,22,23);1H |
| InChIKey | CXSYWQRMSSOGHC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|