C18H27N7O2 — CID 111162578
ethyl 4-[N-ethyl-N'-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]carbamimidoyl]piperazine-1-carboxylate (PubChem CID 111162578) has the molecular formula C18H27N7O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is ethyl 4-[N-ethyl-N'-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]carbamimidoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[N-ethyl-N'-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]carbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111162578 |
| Molecular Formula | C18H27N7O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | ethyl 4-[N-ethyl-N'-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]carbamimidoyl]piperazine-1-carboxylate |
| SMILES | CCN/C(=N\CCc1nnc2ccccn12)N1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C18H27N7O2/c1-3-19-17(23-11-13-24(14-12-23)18(26)27-4-2)20-9-8-16-22-21-15-7-5-6-10-25(15)16/h5-7,10H,3-4,8-9,11-14H2,1-2H3,(H,19,20) |
| InChIKey | VGEBXUAAQUDQBP-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|