C22H28ClN7 — CID 111357434
4-[(3-chlorophenyl)methyl]-N-ethyl-N'-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]piperazine-1-carboximidamide (PubChem CID 111357434) has the molecular formula C22H28ClN7 and a molecular weight of 425.97 g/mol. Its IUPAC name is 4-[(3-chlorophenyl)methyl]-N-ethyl-N'-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]piperazine-1-carboximidamide.
| Compound Name | 4-[(3-chlorophenyl)methyl]-N-ethyl-N'-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111357434 |
| Molecular Formula | C22H28ClN7 |
| Molecular Weight | 425.97 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 4-[(3-chlorophenyl)methyl]-N-ethyl-N'-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1nnc2ccccn12)N1CCN(Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C22H28ClN7/c1-2-24-22(25-10-9-21-27-26-20-8-3-4-11-30(20)21)29-14-12-28(13-15-29)17-18-6-5-7-19(23)16-18/h3-8,11,16H,2,9-10,12-15,17H2,1H3,(H,24,25) |
| InChIKey | NJIRPJUMZZLYEX-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 61.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.97 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|