C21H32ClIN4O — CID 109392529
4-[(3-chlorophenyl)methyl]-N'-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-N-ethylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 109392529) has the molecular formula C21H32ClIN4O and a molecular weight of 518.87 g/mol. Its IUPAC name is 4-[(3-chlorophenyl)methyl]-N'-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-N-ethylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-[(3-chlorophenyl)methyl]-N'-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-N-ethylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109392529 |
| Molecular Formula | C21H32ClIN4O |
| Molecular Weight | 518.87 g/mol |
| Exact Mass | 518.13 |
| IUPAC Name | 4-[(3-chlorophenyl)methyl]-N'-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-N-ethylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCC1=CCOCC1)N1CCN(Cc2cccc(Cl)c2)CC1.I |
| InChI | InChI=1S/C21H31ClN4O.HI/c1-2-23-21(24-9-6-18-7-14-27-15-8-18)26-12-10-25(11-13-26)17-19-4-3-5-20(22)16-19;/h3-5,7,16H,2,6,8-15,17H2,1H3,(H,23,24);1H |
| InChIKey | HOGVGBVBCQSCGK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.87 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|