C19H29ClIN3O2 — CID 109393027
1-[2-(3-chlorophenoxy)ethyl]-2-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-ethyl-1-methylguanidine;hydroiodide (PubChem CID 109393027) has the molecular formula C19H29ClIN3O2 and a molecular weight of 493.82 g/mol. Its IUPAC name is 1-[2-(3-chlorophenoxy)ethyl]-2-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-ethyl-1-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(3-chlorophenoxy)ethyl]-2-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-ethyl-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109393027 |
| Molecular Formula | C19H29ClIN3O2 |
| Molecular Weight | 493.82 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | 1-[2-(3-chlorophenoxy)ethyl]-2-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-ethyl-1-methylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCC1=CCOCC1)N(C)CCOc1cccc(Cl)c1.I |
| InChI | InChI=1S/C19H28ClN3O2.HI/c1-3-21-19(22-10-7-16-8-12-24-13-9-16)23(2)11-14-25-18-6-4-5-17(20)15-18;/h4-6,8,15H,3,7,9-14H2,1-2H3,(H,21,22);1H |
| InChIKey | LWBZOEDDYIZWMS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.82 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|