C18H25ClIN3O3 — CID 111419208
1-[2-(3-chlorophenoxy)ethyl]-3-ethyl-2-[2-(furan-2-yl)-2-hydroxyethyl]-1-methylguanidine;hydroiodide (PubChem CID 111419208) has the molecular formula C18H25ClIN3O3 and a molecular weight of 493.77 g/mol. Its IUPAC name is 1-[2-(3-chlorophenoxy)ethyl]-3-ethyl-2-[2-(furan-2-yl)-2-hydroxyethyl]-1-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(3-chlorophenoxy)ethyl]-3-ethyl-2-[2-(furan-2-yl)-2-hydroxyethyl]-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111419208 |
| Molecular Formula | C18H25ClIN3O3 |
| Molecular Weight | 493.77 g/mol |
| Exact Mass | 493.06 |
| IUPAC Name | 1-[2-(3-chlorophenoxy)ethyl]-3-ethyl-2-[2-(furan-2-yl)-2-hydroxyethyl]-1-methylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccco1)N(C)CCOc1cccc(Cl)c1.I |
| InChI | InChI=1S/C18H24ClN3O3.HI/c1-3-20-18(21-13-16(23)17-8-5-10-25-17)22(2)9-11-24-15-7-4-6-14(19)12-15;/h4-8,10,12,16,23H,3,9,11,13H2,1-2H3,(H,20,21);1H |
| InChIKey | YBGCVCYUZWUQDN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.77 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|