C18H24FN3O3 — CID 111419085
3-ethyl-1-[2-(4-fluorophenoxy)ethyl]-2-[2-(furan-2-yl)-2-hydroxyethyl]-1-methylguanidine (PubChem CID 111419085) has the molecular formula C18H24FN3O3 and a molecular weight of 349.41 g/mol. Its IUPAC name is 3-ethyl-1-[2-(4-fluorophenoxy)ethyl]-2-[2-(furan-2-yl)-2-hydroxyethyl]-1-methylguanidine.
| Compound Name | 3-ethyl-1-[2-(4-fluorophenoxy)ethyl]-2-[2-(furan-2-yl)-2-hydroxyethyl]-1-methylguanidine |
|---|---|
| PubChem CID | 111419085 |
| Molecular Formula | C18H24FN3O3 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 3-ethyl-1-[2-(4-fluorophenoxy)ethyl]-2-[2-(furan-2-yl)-2-hydroxyethyl]-1-methylguanidine |
| SMILES | CCN/C(=N\CC(O)c1ccco1)N(C)CCOc1ccc(F)cc1 |
| InChI | InChI=1S/C18H24FN3O3/c1-3-20-18(21-13-16(23)17-5-4-11-25-17)22(2)10-12-24-15-8-6-14(19)7-9-15/h4-9,11,16,23H,3,10,12-13H2,1-2H3,(H,20,21) |
| InChIKey | RRYOOODUDQVJAT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|