C19H29FIN3O2 — CID 109393021
2-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-ethyl-1-[2-(4-fluorophenoxy)ethyl]-1-methylguanidine;hydroiodide (PubChem CID 109393021) has the molecular formula C19H29FIN3O2 and a molecular weight of 477.36 g/mol. Its IUPAC name is 2-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-ethyl-1-[2-(4-fluorophenoxy)ethyl]-1-methylguanidine;hydroiodide.
| Compound Name | 2-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-ethyl-1-[2-(4-fluorophenoxy)ethyl]-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109393021 |
| Molecular Formula | C19H29FIN3O2 |
| Molecular Weight | 477.36 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | 2-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-ethyl-1-[2-(4-fluorophenoxy)ethyl]-1-methylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCC1=CCOCC1)N(C)CCOc1ccc(F)cc1.I |
| InChI | InChI=1S/C19H28FN3O2.HI/c1-3-21-19(22-11-8-16-9-13-24-14-10-16)23(2)12-15-25-18-6-4-17(20)5-7-18;/h4-7,9H,3,8,10-15H2,1-2H3,(H,21,22);1H |
| InChIKey | NMBCXMGQWULJSH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|