C18H27ClIN3O2 — CID 109392177
1-[2-(4-chlorophenoxy)ethyl]-3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 109392177) has the molecular formula C18H27ClIN3O2 and a molecular weight of 479.79 g/mol. Its IUPAC name is 1-[2-(4-chlorophenoxy)ethyl]-3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-[2-(4-chlorophenoxy)ethyl]-3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109392177 |
| Molecular Formula | C18H27ClIN3O2 |
| Molecular Weight | 479.79 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | 1-[2-(4-chlorophenoxy)ethyl]-3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCC1=CCOCC1)N(C)CCOc1ccc(Cl)cc1.I |
| InChI | InChI=1S/C18H26ClN3O2.HI/c1-20-18(21-10-7-15-8-12-23-13-9-15)22(2)11-14-24-17-5-3-16(19)4-6-17;/h3-6,8H,7,9-14H2,1-2H3,(H,20,21);1H |
| InChIKey | ZQTPFTAOERHNRX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.79 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|