C17H28ClIN4O3S — CID 111308109
1-[2-(4-chlorophenoxy)ethyl]-3-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 111308109) has the molecular formula C17H28ClIN4O3S and a molecular weight of 530.86 g/mol. Its IUPAC name is 1-[2-(4-chlorophenoxy)ethyl]-3-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-[2-(4-chlorophenoxy)ethyl]-3-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111308109 |
| Molecular Formula | C17H28ClIN4O3S |
| Molecular Weight | 530.86 g/mol |
| Exact Mass | 530.06 |
| IUPAC Name | 1-[2-(4-chlorophenoxy)ethyl]-3-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCN1CCS(=O)(=O)CC1)N(C)CCOc1ccc(Cl)cc1.I |
| InChI | InChI=1S/C17H27ClN4O3S.HI/c1-19-17(20-7-8-22-10-13-26(23,24)14-11-22)21(2)9-12-25-16-5-3-15(18)4-6-16;/h3-6H,7-14H2,1-2H3,(H,19,20);1H |
| InChIKey | IKUJCZVEODYJIW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.86 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|