C17H29ClIN3O3 — CID 111308617
1-[2-(4-chlorophenoxy)ethyl]-3-[3-(2-methoxyethoxy)propyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 111308617) has the molecular formula C17H29ClIN3O3 and a molecular weight of 485.79 g/mol. Its IUPAC name is 1-[2-(4-chlorophenoxy)ethyl]-3-[3-(2-methoxyethoxy)propyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-[2-(4-chlorophenoxy)ethyl]-3-[3-(2-methoxyethoxy)propyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111308617 |
| Molecular Formula | C17H29ClIN3O3 |
| Molecular Weight | 485.79 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | 1-[2-(4-chlorophenoxy)ethyl]-3-[3-(2-methoxyethoxy)propyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOCCOC)N(C)CCOc1ccc(Cl)cc1.I |
| InChI | InChI=1S/C17H28ClN3O3.HI/c1-19-17(20-9-4-11-23-14-13-22-3)21(2)10-12-24-16-7-5-15(18)6-8-16;/h5-8H,4,9-14H2,1-3H3,(H,19,20);1H |
| InChIKey | UBRYJNRZRYPSPI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.79 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|