C17H24BrN3O — CID 109392092
1-[(4-bromophenyl)methyl]-3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1,2-dimethylguanidine (PubChem CID 109392092) has the molecular formula C17H24BrN3O and a molecular weight of 366.30 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1,2-dimethylguanidine.
| Compound Name | 1-[(4-bromophenyl)methyl]-3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 109392092 |
| Molecular Formula | C17H24BrN3O |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(\NCCC1=CCOCC1)N(C)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H24BrN3O/c1-19-17(20-10-7-14-8-11-22-12-9-14)21(2)13-15-3-5-16(18)6-4-15/h3-6,8H,7,9-13H2,1-2H3,(H,19,20) |
| InChIKey | CNDSTBBJOSZNBG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|