C18H26IN3O3 — CID 109392693
1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 109392693) has the molecular formula C18H26IN3O3 and a molecular weight of 459.33 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109392693 |
| Molecular Formula | C18H26IN3O3 |
| Molecular Weight | 459.33 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCC1=CCOCC1)N(C)Cc1ccc2c(c1)OCO2.I |
| InChI | InChI=1S/C18H25N3O3.HI/c1-19-18(20-8-5-14-6-9-22-10-7-14)21(2)12-15-3-4-16-17(11-15)24-13-23-16;/h3-4,6,11H,5,7-10,12-13H2,1-2H3,(H,19,20);1H |
| InChIKey | AQDSDHAZIWOXEN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|