C18H25IN4O3 — CID 75512763
1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 75512763) has the molecular formula C18H25IN4O3 and a molecular weight of 472.33 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 75512763 |
| Molecular Formula | C18H25IN4O3 |
| Molecular Weight | 472.33 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1c(C)noc1C)N(C)Cc1ccc2c(c1)OCO2.I |
| InChI | InChI=1S/C18H24N4O3.HI/c1-12-15(13(2)25-21-12)7-8-20-18(19-3)22(4)10-14-5-6-16-17(9-14)24-11-23-16;/h5-6,9H,7-8,10-11H2,1-4H3,(H,19,20);1H |
| InChIKey | IOEGXTISURILFO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 72.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|