C18H24N4O2S — CID 111517855
1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-1,2-dimethylguanidine (PubChem CID 111517855) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-1,2-dimethylguanidine.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111517855 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-1,2-dimethylguanidine |
| SMILES | CCc1cnc(CCN/C(=N\C)N(C)Cc2ccc3c(c2)OCO3)s1 |
| InChI | InChI=1S/C18H24N4O2S/c1-4-14-10-21-17(25-14)7-8-20-18(19-2)22(3)11-13-5-6-15-16(9-13)24-12-23-15/h5-6,9-10H,4,7-8,11-12H2,1-3H3,(H,19,20) |
| InChIKey | PAACMVGPKALDOH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 58.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|