C17H16N2O3S — CID 71969307
3-(1,3-benzodioxol-5-yl)-N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]prop-2-ynamide (PubChem CID 71969307) has the molecular formula C17H16N2O3S and a molecular weight of 328.39 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]prop-2-ynamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]prop-2-ynamide |
|---|---|
| PubChem CID | 71969307 |
| Molecular Formula | C17H16N2O3S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]prop-2-ynamide |
| SMILES | CCc1cnc(CCNC(=O)C#Cc2ccc3c(c2)OCO3)s1 |
| InChI | InChI=1S/C17H16N2O3S/c1-2-13-10-19-17(23-13)7-8-18-16(20)6-4-12-3-5-14-15(9-12)22-11-21-14/h3,5,9-10H,2,7-8,11H2,1H3,(H,18,20) |
| InChIKey | GGTMKRSKZOYUIV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|