C16H26IN5OS — CID 109421395
3-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109421395) has the molecular formula C16H26IN5OS and a molecular weight of 463.39 g/mol. Its IUPAC name is 3-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109421395 |
| Molecular Formula | C16H26IN5OS |
| Molecular Weight | 463.39 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | 3-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCc1c(C)noc1C)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C16H25N5OS.HI/c1-11-15(12(2)22-20-11)7-6-8-18-16(17-4)21(5)9-14-10-23-13(3)19-14;/h10H,6-9H2,1-5H3,(H,17,18);1H |
| InChIKey | DIUQWKORCORLFA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 66.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|