C20H32IN3O3 — CID 109392701
3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1-[(4,5-dimethoxy-2-methylphenyl)methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 109392701) has the molecular formula C20H32IN3O3 and a molecular weight of 489.40 g/mol. Its IUPAC name is 3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1-[(4,5-dimethoxy-2-methylphenyl)methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1-[(4,5-dimethoxy-2-methylphenyl)methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109392701 |
| Molecular Formula | C20H32IN3O3 |
| Molecular Weight | 489.40 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | 3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1-[(4,5-dimethoxy-2-methylphenyl)methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCC1=CCOCC1)N(C)Cc1cc(OC)c(OC)cc1C.I |
| InChI | InChI=1S/C20H31N3O3.HI/c1-15-12-18(24-4)19(25-5)13-17(15)14-23(3)20(21-2)22-9-6-16-7-10-26-11-8-16;/h7,12-13H,6,8-11,14H2,1-5H3,(H,21,22);1H |
| InChIKey | GBTWAAPEABGZFX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|