C15H22BrN3O — CID 86777646
1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-(oxolan-3-ylmethyl)guanidine (PubChem CID 86777646) has the molecular formula C15H22BrN3O and a molecular weight of 340.26 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-(oxolan-3-ylmethyl)guanidine.
| Compound Name | 1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-(oxolan-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 86777646 |
| Molecular Formula | C15H22BrN3O |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-(oxolan-3-ylmethyl)guanidine |
| SMILES | C/N=C(\NCC1CCOC1)N(C)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H22BrN3O/c1-17-15(18-9-13-7-8-20-11-13)19(2)10-12-3-5-14(16)6-4-12/h3-6,13H,7-11H2,1-2H3,(H,17,18) |
| InChIKey | XKRHIZBLGBFTKO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|