C17H28IN3O3 — CID 111296030
1-[(2,4-dimethoxyphenyl)methyl]-1,2-dimethyl-3-(oxolan-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111296030) has the molecular formula C17H28IN3O3 and a molecular weight of 449.33 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl]-1,2-dimethyl-3-(oxolan-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl]-1,2-dimethyl-3-(oxolan-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111296030 |
| Molecular Formula | C17H28IN3O3 |
| Molecular Weight | 449.33 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl]-1,2-dimethyl-3-(oxolan-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCC1CCOC1)N(C)Cc1ccc(OC)cc1OC.I |
| InChI | InChI=1S/C17H27N3O3.HI/c1-18-17(19-10-13-7-8-23-12-13)20(2)11-14-5-6-15(21-3)9-16(14)22-4;/h5-6,9,13H,7-8,10-12H2,1-4H3,(H,18,19);1H |
| InChIKey | NVRBKVUEBLJBLH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|