C16H28IN3O3 — CID 111296474
1-[(2,4-dimethoxyphenyl)methyl]-3-(2-ethoxyethyl)-1,2-dimethylguanidine;hydroiodide (PubChem CID 111296474) has the molecular formula C16H28IN3O3 and a molecular weight of 437.32 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl]-3-(2-ethoxyethyl)-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl]-3-(2-ethoxyethyl)-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111296474 |
| Molecular Formula | C16H28IN3O3 |
| Molecular Weight | 437.32 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl]-3-(2-ethoxyethyl)-1,2-dimethylguanidine;hydroiodide |
| SMILES | CCOCCN/C(=N\C)N(C)Cc1ccc(OC)cc1OC.I |
| InChI | InChI=1S/C16H27N3O3.HI/c1-6-22-10-9-18-16(17-2)19(3)12-13-7-8-14(20-4)11-15(13)21-5;/h7-8,11H,6,9-10,12H2,1-5H3,(H,17,18);1H |
| InChIKey | ZVRZAXBLTVGXFJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|