C22H31N3O4 — CID 111297099
3-[2-(3,4-dimethoxyphenyl)ethyl]-1-[(2,4-dimethoxyphenyl)methyl]-1,2-dimethylguanidine (PubChem CID 111297099) has the molecular formula C22H31N3O4 and a molecular weight of 401.51 g/mol. Its IUPAC name is 3-[2-(3,4-dimethoxyphenyl)ethyl]-1-[(2,4-dimethoxyphenyl)methyl]-1,2-dimethylguanidine.
| Compound Name | 3-[2-(3,4-dimethoxyphenyl)ethyl]-1-[(2,4-dimethoxyphenyl)methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111297099 |
| Molecular Formula | C22H31N3O4 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | 3-[2-(3,4-dimethoxyphenyl)ethyl]-1-[(2,4-dimethoxyphenyl)methyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(\NCCc1ccc(OC)c(OC)c1)N(C)Cc1ccc(OC)cc1OC |
| InChI | InChI=1S/C22H31N3O4/c1-23-22(24-12-11-16-7-10-19(27-4)21(13-16)29-6)25(2)15-17-8-9-18(26-3)14-20(17)28-5/h7-10,13-14H,11-12,15H2,1-6H3,(H,23,24) |
| InChIKey | HGIRXMVIDFTBDC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 64.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|