C15H25N3O4S — CID 111296749
1-[(2,4-dimethoxyphenyl)methyl]-1,2-dimethyl-3-(2-methylsulfonylethyl)guanidine (PubChem CID 111296749) has the molecular formula C15H25N3O4S and a molecular weight of 343.45 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl]-1,2-dimethyl-3-(2-methylsulfonylethyl)guanidine.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl]-1,2-dimethyl-3-(2-methylsulfonylethyl)guanidine |
|---|---|
| PubChem CID | 111296749 |
| Molecular Formula | C15H25N3O4S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl]-1,2-dimethyl-3-(2-methylsulfonylethyl)guanidine |
| SMILES | C/N=C(\NCCS(C)(=O)=O)N(C)Cc1ccc(OC)cc1OC |
| InChI | InChI=1S/C15H25N3O4S/c1-16-15(17-8-9-23(5,19)20)18(2)11-12-6-7-13(21-3)10-14(12)22-4/h6-7,10H,8-9,11H2,1-5H3,(H,16,17) |
| InChIKey | JPQIMRNKGDJMHO-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|