C21H30IN3O4S — CID 111297210
3-[3-(benzenesulfonyl)propyl]-1-[(2,4-dimethoxyphenyl)methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 111297210) has the molecular formula C21H30IN3O4S and a molecular weight of 547.46 g/mol. Its IUPAC name is 3-[3-(benzenesulfonyl)propyl]-1-[(2,4-dimethoxyphenyl)methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 3-[3-(benzenesulfonyl)propyl]-1-[(2,4-dimethoxyphenyl)methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111297210 |
| Molecular Formula | C21H30IN3O4S |
| Molecular Weight | 547.46 g/mol |
| Exact Mass | 547.10 |
| IUPAC Name | 3-[3-(benzenesulfonyl)propyl]-1-[(2,4-dimethoxyphenyl)methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCS(=O)(=O)c1ccccc1)N(C)Cc1ccc(OC)cc1OC.I |
| InChI | InChI=1S/C21H29N3O4S.HI/c1-22-21(23-13-8-14-29(25,26)19-9-6-5-7-10-19)24(2)16-17-11-12-18(27-3)15-20(17)28-4;/h5-7,9-12,15H,8,13-14,16H2,1-4H3,(H,22,23);1H |
| InChIKey | UHQDGILZUIERLK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|