C17H27F3IN3O3 — CID 111296214
1-[(2,4-dimethoxyphenyl)methyl]-1,2-dimethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide (PubChem CID 111296214) has the molecular formula C17H27F3IN3O3 and a molecular weight of 505.32 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl]-1,2-dimethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl]-1,2-dimethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111296214 |
| Molecular Formula | C17H27F3IN3O3 |
| Molecular Weight | 505.32 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl]-1,2-dimethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOCC(F)(F)F)N(C)Cc1ccc(OC)cc1OC.I |
| InChI | InChI=1S/C17H26F3N3O3.HI/c1-21-16(22-8-5-9-26-12-17(18,19)20)23(2)11-13-6-7-14(24-3)10-15(13)25-4;/h6-7,10H,5,8-9,11-12H2,1-4H3,(H,21,22);1H |
| InChIKey | TZDHLVWXOXVYSP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|