C24H35IN4O3 — CID 111296926
1-[(2,4-dimethoxyphenyl)methyl]-3-[[1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 111296926) has the molecular formula C24H35IN4O3 and a molecular weight of 554.47 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl]-3-[[1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl]-3-[[1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111296926 |
| Molecular Formula | C24H35IN4O3 |
| Molecular Weight | 554.47 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl]-3-[[1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NCC1CCN(c2cccc(OC)c2)C1)N(C)Cc1ccc(OC)cc1OC.I |
| InChI | InChI=1S/C24H34N4O3.HI/c1-25-24(27(2)17-19-9-10-22(30-4)14-23(19)31-5)26-15-18-11-12-28(16-18)20-7-6-8-21(13-20)29-3;/h6-10,13-14,18H,11-12,15-17H2,1-5H3,(H,25,26);1H |
| InChIKey | ILWUSKUDRRCYCB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|