C22H31IN4 — CID 111287100
1,2-dimethyl-1-[(2-methylphenyl)methyl]-3-[(1-phenylpyrrolidin-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111287100) has the molecular formula C22H31IN4 and a molecular weight of 478.42 g/mol. Its IUPAC name is 1,2-dimethyl-1-[(2-methylphenyl)methyl]-3-[(1-phenylpyrrolidin-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-1-[(2-methylphenyl)methyl]-3-[(1-phenylpyrrolidin-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111287100 |
| Molecular Formula | C22H31IN4 |
| Molecular Weight | 478.42 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | 1,2-dimethyl-1-[(2-methylphenyl)methyl]-3-[(1-phenylpyrrolidin-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCC1CCN(c2ccccc2)C1)N(C)Cc1ccccc1C.I |
| InChI | InChI=1S/C22H30N4.HI/c1-18-9-7-8-10-20(18)17-25(3)22(23-2)24-15-19-13-14-26(16-19)21-11-5-4-6-12-21;/h4-12,19H,13-17H2,1-3H3,(H,23,24);1H |
| InChIKey | HUTXBLRDIXCEKO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|