C23H31N5O — CID 111287561
1,2-dimethyl-1-[(2-methylphenyl)methyl]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]guanidine (PubChem CID 111287561) has the molecular formula C23H31N5O and a molecular weight of 393.54 g/mol. Its IUPAC name is 1,2-dimethyl-1-[(2-methylphenyl)methyl]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]guanidine.
| Compound Name | 1,2-dimethyl-1-[(2-methylphenyl)methyl]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111287561 |
| Molecular Formula | C23H31N5O |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | 1,2-dimethyl-1-[(2-methylphenyl)methyl]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]guanidine |
| SMILES | C/N=C(/NCC(=O)N1CCN(c2ccccc2)CC1)N(C)Cc1ccccc1C |
| InChI | InChI=1S/C23H31N5O/c1-19-9-7-8-10-20(19)18-26(3)23(24-2)25-17-22(29)28-15-13-27(14-16-28)21-11-5-4-6-12-21/h4-12H,13-18H2,1-3H3,(H,24,25) |
| InChIKey | YOGIAAMATMLNSC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|