C24H33N5O3 — CID 111297381
1-[(2,4-dimethoxyphenyl)methyl]-1,2-dimethyl-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]guanidine (PubChem CID 111297381) has the molecular formula C24H33N5O3 and a molecular weight of 439.56 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl]-1,2-dimethyl-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]guanidine.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl]-1,2-dimethyl-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111297381 |
| Molecular Formula | C24H33N5O3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl]-1,2-dimethyl-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]guanidine |
| SMILES | C/N=C(\NCC(=O)N1CCN(c2ccccc2)CC1)N(C)Cc1ccc(OC)cc1OC |
| InChI | InChI=1S/C24H33N5O3/c1-25-24(27(2)18-19-10-11-21(31-3)16-22(19)32-4)26-17-23(30)29-14-12-28(13-15-29)20-8-6-5-7-9-20/h5-11,16H,12-15,17-18H2,1-4H3,(H,25,26) |
| InChIKey | NPXFRFROHJTRAD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|