C20H25FN4O3 — CID 111297383
2-[[N-[(2,4-dimethoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]-N-(4-fluorophenyl)acetamide (PubChem CID 111297383) has the molecular formula C20H25FN4O3 and a molecular weight of 388.44 g/mol. Its IUPAC name is 2-[[N-[(2,4-dimethoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[[N-[(2,4-dimethoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 111297383 |
| Molecular Formula | C20H25FN4O3 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 2-[[N-[(2,4-dimethoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]-N-(4-fluorophenyl)acetamide |
| SMILES | C/N=C(\NCC(=O)Nc1ccc(F)cc1)N(C)Cc1ccc(OC)cc1OC |
| InChI | InChI=1S/C20H25FN4O3/c1-22-20(23-12-19(26)24-16-8-6-15(21)7-9-16)25(2)13-14-5-10-17(27-3)11-18(14)28-4/h5-11H,12-13H2,1-4H3,(H,22,23)(H,24,26) |
| InChIKey | BASLHYDXIACCCB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|