C23H32N4O3 — CID 111297069
N-[4-[[[N-[(2,4-dimethoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]phenyl]butanamide (PubChem CID 111297069) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is N-[4-[[[N-[(2,4-dimethoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]phenyl]butanamide.
| Compound Name | N-[4-[[[N-[(2,4-dimethoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]phenyl]butanamide |
|---|---|
| PubChem CID | 111297069 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | N-[4-[[[N-[(2,4-dimethoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(CN/C(=N\C)N(C)Cc2ccc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C23H32N4O3/c1-6-7-22(28)26-19-11-8-17(9-12-19)15-25-23(24-2)27(3)16-18-10-13-20(29-4)14-21(18)30-5/h8-14H,6-7,15-16H2,1-5H3,(H,24,25)(H,26,28) |
| InChIKey | FDOBJBATTZCAFC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|