C25H31IN4O3 — CID 111296258
1-[(2,4-dimethoxyphenyl)methyl]-1,2-dimethyl-3-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]guanidine;hydroiodide (PubChem CID 111296258) has the molecular formula C25H31IN4O3 and a molecular weight of 562.45 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl]-1,2-dimethyl-3-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl]-1,2-dimethyl-3-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111296258 |
| Molecular Formula | C25H31IN4O3 |
| Molecular Weight | 562.45 g/mol |
| Exact Mass | 562.14 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl]-1,2-dimethyl-3-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(Cn2ccccc2=O)cc1)N(C)Cc1ccc(OC)cc1OC.I |
| InChI | InChI=1S/C25H30N4O3.HI/c1-26-25(28(2)18-21-12-13-22(31-3)15-23(21)32-4)27-16-19-8-10-20(11-9-19)17-29-14-6-5-7-24(29)30;/h5-15H,16-18H2,1-4H3,(H,26,27);1H |
| InChIKey | HXOMYFBKQGQSPW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 68.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|