C24H34N4O3 — CID 111296061
N-butan-2-yl-4-[[[N-[(2,4-dimethoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]benzamide (PubChem CID 111296061) has the molecular formula C24H34N4O3 and a molecular weight of 426.56 g/mol. Its IUPAC name is N-butan-2-yl-4-[[[N-[(2,4-dimethoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]benzamide.
| Compound Name | N-butan-2-yl-4-[[[N-[(2,4-dimethoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111296061 |
| Molecular Formula | C24H34N4O3 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | N-butan-2-yl-4-[[[N-[(2,4-dimethoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]benzamide |
| SMILES | CCC(C)NC(=O)c1ccc(CN/C(=N\C)N(C)Cc2ccc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C24H34N4O3/c1-7-17(2)27-23(29)19-10-8-18(9-11-19)15-26-24(25-3)28(4)16-20-12-13-21(30-5)14-22(20)31-6/h8-14,17H,7,15-16H2,1-6H3,(H,25,26)(H,27,29) |
| InChIKey | RQXGORYYRGJNTP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|