C21H28ClIN4 — CID 111305606
1-[(3-chlorophenyl)methyl]-1,2-dimethyl-3-[(1-phenylpyrrolidin-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111305606) has the molecular formula C21H28ClIN4 and a molecular weight of 498.84 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-1,2-dimethyl-3-[(1-phenylpyrrolidin-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(3-chlorophenyl)methyl]-1,2-dimethyl-3-[(1-phenylpyrrolidin-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111305606 |
| Molecular Formula | C21H28ClIN4 |
| Molecular Weight | 498.84 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-1,2-dimethyl-3-[(1-phenylpyrrolidin-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCC1CCN(c2ccccc2)C1)N(C)Cc1cccc(Cl)c1.I |
| InChI | InChI=1S/C21H27ClN4.HI/c1-23-21(25(2)15-17-7-6-8-19(22)13-17)24-14-18-11-12-26(16-18)20-9-4-3-5-10-20;/h3-10,13,18H,11-12,14-16H2,1-2H3,(H,23,24);1H |
| InChIKey | NOBGYTMLCUCZHR-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.84 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|