C23H33IN4OS — CID 111299264
3-[[1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]-1,2-dimethyl-1-[(4-methylsulfanylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111299264) has the molecular formula C23H33IN4OS and a molecular weight of 540.52 g/mol. Its IUPAC name is 3-[[1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]-1,2-dimethyl-1-[(4-methylsulfanylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 3-[[1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]-1,2-dimethyl-1-[(4-methylsulfanylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111299264 |
| Molecular Formula | C23H33IN4OS |
| Molecular Weight | 540.52 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | 3-[[1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]-1,2-dimethyl-1-[(4-methylsulfanylphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCC1CCN(c2cccc(OC)c2)C1)N(C)Cc1ccc(SC)cc1.I |
| InChI | InChI=1S/C23H32N4OS.HI/c1-24-23(26(2)16-18-8-10-22(29-4)11-9-18)25-15-19-12-13-27(17-19)20-6-5-7-21(14-20)28-3;/h5-11,14,19H,12-13,15-17H2,1-4H3,(H,24,25);1H |
| InChIKey | XESNQLANLPDTHL-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.52 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|