C15H21Cl2N3O — CID 111306025
1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-(oxolan-3-ylmethyl)guanidine (PubChem CID 111306025) has the molecular formula C15H21Cl2N3O and a molecular weight of 330.26 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-(oxolan-3-ylmethyl)guanidine.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-(oxolan-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111306025 |
| Molecular Formula | C15H21Cl2N3O |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-(oxolan-3-ylmethyl)guanidine |
| SMILES | C/N=C(\NCC1CCOC1)N(C)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H21Cl2N3O/c1-18-15(19-8-12-5-6-21-10-12)20(2)9-11-3-4-13(16)14(17)7-11/h3-4,7,12H,5-6,8-10H2,1-2H3,(H,18,19) |
| InChIKey | ODMCNGZDFXAMOB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|