C15H23ClIN3O2 — CID 119132025
1-[(3-chlorophenyl)methyl]-3-(1,4-dioxan-2-ylmethyl)-1,2-dimethylguanidine;hydroiodide (PubChem CID 119132025) has the molecular formula C15H23ClIN3O2 and a molecular weight of 439.73 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-3-(1,4-dioxan-2-ylmethyl)-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-[(3-chlorophenyl)methyl]-3-(1,4-dioxan-2-ylmethyl)-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119132025 |
| Molecular Formula | C15H23ClIN3O2 |
| Molecular Weight | 439.73 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-3-(1,4-dioxan-2-ylmethyl)-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NCC1COCCO1)N(C)Cc1cccc(Cl)c1.I |
| InChI | InChI=1S/C15H22ClN3O2.HI/c1-17-15(18-9-14-11-20-6-7-21-14)19(2)10-12-4-3-5-13(16)8-12;/h3-5,8,14H,6-7,9-11H2,1-2H3,(H,17,18);1H |
| InChIKey | DXNFYCKKFDJPDE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.73 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|